C24H22N6OS3 — CID 58644570
(5Z)-5-[[4-(8-aminonaphthalen-2-yl)thiophen-2-yl]methylidene]-2-sulfanylidene-3-[5-(2H-tetrazol-5-yl)pentyl]-1,3-thiazolidin-4-one (PubChem CID 58644570) has the molecular formula C24H22N6OS3 and a molecular weight of 506.68 g/mol. Its IUPAC name is (5Z)-5-[[4-(8-aminonaphthalen-2-yl)thiophen-2-yl]methylidene]-2-sulfanylidene-3-[5-(2H-tetrazol-5-yl)pentyl]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-(8-aminonaphthalen-2-yl)thiophen-2-yl]methylidene]-2-sulfanylidene-3-[5-(2H-tetrazol-5-yl)pentyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58644570 |
| Molecular Formula | C24H22N6OS3 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | (5Z)-5-[[4-(8-aminonaphthalen-2-yl)thiophen-2-yl]methylidene]-2-sulfanylidene-3-[5-(2H-tetrazol-5-yl)pentyl]-1,3-thiazolidin-4-one |
| SMILES | Nc1cccc2ccc(-c3csc(/C=C4\SC(=S)N(CCCCCc5nn[nH]n5)C4=O)c3)cc12 |
| InChI | InChI=1S/C24H22N6OS3/c25-20-6-4-5-15-8-9-16(12-19(15)20)17-11-18(33-14-17)13-21-23(31)30(24(32)34-21)10-3-1-2-7-22-26-28-29-27-22/h4-6,8-9,11-14H,1-3,7,10,25H2,(H,26,27,28,29)/b21-13- |
| InChIKey | KNGRKIANKATLQO-BKUYFWCQSA-N |
| XLogP | 5.28 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|