C27H19F6NO5S3 — CID 72981992
4-[3-[5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid (PubChem CID 72981992) has the molecular formula C27H19F6NO5S3 and a molecular weight of 647.64 g/mol. Its IUPAC name is 4-[3-[5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid.
| Compound Name | 4-[3-[5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 72981992 |
| Molecular Formula | C27H19F6NO5S3 |
| Molecular Weight | 647.64 g/mol |
| Exact Mass | 647.03 |
| IUPAC Name | 4-[3-[5-[[4-[3,5-bis(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1OCCCN1C(=O)C(=Cc2cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cs2)SC1=S |
| InChI | InChI=1S/C27H19F6NO5S3/c1-38-21-10-14(24(36)37)3-4-20(21)39-6-2-5-34-23(35)22(42-25(34)40)12-19-9-16(13-41-19)15-7-17(26(28,29)30)11-18(8-15)27(31,32)33/h3-4,7-13H,2,5-6H2,1H3,(H,36,37) |
| InChIKey | VKOCRZLMTQANPF-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.64 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|