C25H17ClF3NO4S3 — CID 58644345
4-[3-[(5Z)-5-[[4-[2-chloro-5-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]benzoic acid (PubChem CID 58644345) has the molecular formula C25H17ClF3NO4S3 and a molecular weight of 584.06 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[4-[2-chloro-5-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]benzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[4-[2-chloro-5-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]benzoic acid |
|---|---|
| PubChem CID | 58644345 |
| Molecular Formula | C25H17ClF3NO4S3 |
| Molecular Weight | 584.06 g/mol |
| Exact Mass | 583.00 |
| IUPAC Name | 4-[3-[(5Z)-5-[[4-[2-chloro-5-(trifluoromethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCCN2C(=O)/C(=C/c3cc(-c4cc(C(F)(F)F)ccc4Cl)cs3)SC2=S)cc1 |
| InChI | InChI=1S/C25H17ClF3NO4S3/c26-20-7-4-16(25(27,28)29)11-19(20)15-10-18(36-13-15)12-21-22(31)30(24(35)37-21)8-1-9-34-17-5-2-14(3-6-17)23(32)33/h2-7,10-13H,1,8-9H2,(H,32,33)/b21-12- |
| InChIKey | YMBWKVFJUIVIPG-MTJSOVHGSA-N |
| XLogP | 7.46 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.06 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|