C30H22F6N2O6S2 — CID 58643995
4-[3-[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-methoxybenzoic acid (PubChem CID 58643995) has the molecular formula C30H22F6N2O6S2 and a molecular weight of 684.64 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-methoxybenzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 58643995 |
| Molecular Formula | C30H22F6N2O6S2 |
| Molecular Weight | 684.64 g/mol |
| Exact Mass | 684.08 |
| IUPAC Name | 4-[3-[(5Z)-5-[[5-[3,5-bis(trifluoromethyl)phenyl]-2-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-methoxybenzoic acid |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1/C=C1\SC(=S)N(CCC(=O)Nc2ccc(C(=O)O)cc2OC)C1=O |
| InChI | InChI=1S/C30H22F6N2O6S2/c1-43-22-6-4-15(17-10-19(29(31,32)33)14-20(11-17)30(34,35)36)9-18(22)13-24-26(40)38(28(45)46-24)8-7-25(39)37-21-5-3-16(27(41)42)12-23(21)44-2/h3-6,9-14H,7-8H2,1-2H3,(H,37,39)(H,41,42)/b24-13- |
| InChIKey | RGPDXXASBBURSY-CFRMEGHHSA-N |
| XLogP | 7.34 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.64 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|