C30H26F2N2O8S2 — CID 58644655
4-[3-[(5Z)-5-[[5-(3,4-difluorophenyl)-2,3-dimethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3,5-dimethoxybenzoic acid (PubChem CID 58644655) has the molecular formula C30H26F2N2O8S2 and a molecular weight of 644.67 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[5-(3,4-difluorophenyl)-2,3-dimethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3,5-dimethoxybenzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[5-(3,4-difluorophenyl)-2,3-dimethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 58644655 |
| Molecular Formula | C30H26F2N2O8S2 |
| Molecular Weight | 644.67 g/mol |
| Exact Mass | 644.11 |
| IUPAC Name | 4-[3-[(5Z)-5-[[5-(3,4-difluorophenyl)-2,3-dimethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3,5-dimethoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(OC)c1NC(=O)CCN1C(=O)/C(=C/c2cc(-c3ccc(F)c(F)c3)cc(OC)c2OC)SC1=S |
| InChI | InChI=1S/C30H26F2N2O8S2/c1-39-21-12-18(29(37)38)13-22(40-2)26(21)33-25(35)7-8-34-28(36)24(44-30(34)43)14-17-9-16(11-23(41-3)27(17)42-4)15-5-6-19(31)20(32)10-15/h5-6,9-14H,7-8H2,1-4H3,(H,33,35)(H,37,38)/b24-14- |
| InChIKey | FXOITFRKZHUPES-OYKKKHCWSA-N |
| XLogP | 5.59 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.67 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|