C29H20F6N2O5S2 — CID 58643701
4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methylphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid (PubChem CID 58643701) has the molecular formula C29H20F6N2O5S2 and a molecular weight of 654.61 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methylphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methylphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 58643701 |
| Molecular Formula | C29H20F6N2O5S2 |
| Molecular Weight | 654.61 g/mol |
| Exact Mass | 654.07 |
| IUPAC Name | 4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-2-hydroxy-5-methylphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
| SMILES | Cc1cc(/C=C2\SC(=S)N(CCC(=O)Nc3ccc(C(=O)O)cc3)C2=O)c(O)c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C29H20F6N2O5S2/c1-14-8-17(24(39)21(9-14)16-10-18(28(30,31)32)13-19(11-16)29(33,34)35)12-22-25(40)37(27(43)44-22)7-6-23(38)36-20-4-2-15(3-5-20)26(41)42/h2-5,8-13,39H,6-7H2,1H3,(H,36,38)(H,41,42)/b22-12- |
| InChIKey | OSALUJXGRIGULN-UUYOSTAYSA-N |
| XLogP | 7.33 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.61 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|