C31H22F6N2O8S2 — CID 58643000
4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-4-(carboxymethoxy)-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid (PubChem CID 58643000) has the molecular formula C31H22F6N2O8S2 and a molecular weight of 728.64 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-4-(carboxymethoxy)-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-4-(carboxymethoxy)-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 58643000 |
| Molecular Formula | C31H22F6N2O8S2 |
| Molecular Weight | 728.64 g/mol |
| Exact Mass | 728.07 |
| IUPAC Name | 4-[3-[(5Z)-5-[[3-[3,5-bis(trifluoromethyl)phenyl]-4-(carboxymethoxy)-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoic acid |
| SMILES | COc1cc(/C=C2\SC(=S)N(CCC(=O)Nc3ccc(C(=O)O)cc3)C2=O)cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1OCC(=O)O |
| InChI | InChI=1S/C31H22F6N2O8S2/c1-46-22-9-15(8-21(26(22)47-14-25(41)42)17-11-18(30(32,33)34)13-19(12-17)31(35,36)37)10-23-27(43)39(29(48)49-23)7-6-24(40)38-20-4-2-16(3-5-20)28(44)45/h2-5,8-13H,6-7,14H2,1H3,(H,38,40)(H,41,42)(H,44,45)/b23-10- |
| InChIKey | QHTQEDIQFTYEMU-RMORIDSASA-N |
| XLogP | 6.79 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.64 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|