C28H22Cl2N2O6S2 — CID 58642995
4-[3-[(5Z)-5-[[3-(2,5-dichlorophenyl)-4-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-methoxybenzoic acid (PubChem CID 58642995) has the molecular formula C28H22Cl2N2O6S2 and a molecular weight of 617.53 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[3-(2,5-dichlorophenyl)-4-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-methoxybenzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[3-(2,5-dichlorophenyl)-4-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 58642995 |
| Molecular Formula | C28H22Cl2N2O6S2 |
| Molecular Weight | 617.53 g/mol |
| Exact Mass | 616.03 |
| IUPAC Name | 4-[3-[(5Z)-5-[[3-(2,5-dichlorophenyl)-4-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NC(=O)CCN1C(=O)/C(=C/c2ccc(OC)c(-c3cc(Cl)ccc3Cl)c2)SC1=S |
| InChI | InChI=1S/C28H22Cl2N2O6S2/c1-37-22-8-3-15(11-19(22)18-14-17(29)5-6-20(18)30)12-24-26(34)32(28(39)40-24)10-9-25(33)31-21-7-4-16(27(35)36)13-23(21)38-2/h3-8,11-14H,9-10H2,1-2H3,(H,31,33)(H,35,36)/b24-12- |
| InChIKey | XPLPMGLKZCOLFC-MSXFZWOLSA-N |
| XLogP | 6.61 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.53 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|