C25H25F2N3O5S2 — CID 58642428
3-[[(5Z)-5-[[5-(3,4-difluorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]propanoic acid (PubChem CID 58642428) has the molecular formula C25H25F2N3O5S2 and a molecular weight of 549.62 g/mol. Its IUPAC name is 3-[[(5Z)-5-[[5-(3,4-difluorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]propanoic acid.
| Compound Name | 3-[[(5Z)-5-[[5-(3,4-difluorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 58642428 |
| Molecular Formula | C25H25F2N3O5S2 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | 3-[[(5Z)-5-[[5-(3,4-difluorophenyl)-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]amino]propanoic acid |
| SMILES | O=C(O)CCNN1C(=O)/C(=C/c2cc(-c3ccc(F)c(F)c3)ccc2OCCN2CCOCC2)SC1=S |
| InChI | InChI=1S/C25H25F2N3O5S2/c26-19-3-1-17(14-20(19)27)16-2-4-21(35-12-9-29-7-10-34-11-8-29)18(13-16)15-22-24(33)30(25(36)37-22)28-6-5-23(31)32/h1-4,13-15,28H,5-12H2,(H,31,32)/b22-15- |
| InChIKey | HYGABNFQHBQRSX-JCMHNJIXSA-N |
| XLogP | 3.52 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|