C31H28Cl2N2O5S2 — CID 58642509
phenyl 3-[(5Z)-5-[[3-(2,4-dichlorophenyl)-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate (PubChem CID 58642509) has the molecular formula C31H28Cl2N2O5S2 and a molecular weight of 643.61 g/mol. Its IUPAC name is phenyl 3-[(5Z)-5-[[3-(2,4-dichlorophenyl)-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | phenyl 3-[(5Z)-5-[[3-(2,4-dichlorophenyl)-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 58642509 |
| Molecular Formula | C31H28Cl2N2O5S2 |
| Molecular Weight | 643.61 g/mol |
| Exact Mass | 642.08 |
| IUPAC Name | phenyl 3-[(5Z)-5-[[3-(2,4-dichlorophenyl)-4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
| SMILES | O=C(CCN1C(=O)/C(=C/c2ccc(OCCN3CCOCC3)c(-c3ccc(Cl)cc3Cl)c2)SC1=S)Oc1ccccc1 |
| InChI | InChI=1S/C31H28Cl2N2O5S2/c32-22-7-8-24(26(33)20-22)25-18-21(6-9-27(25)39-17-14-34-12-15-38-16-13-34)19-28-30(37)35(31(41)42-28)11-10-29(36)40-23-4-2-1-3-5-23/h1-9,18-20H,10-17H2/b28-19- |
| InChIKey | MNEWIKPCIKKUIX-USHMODERSA-N |
| XLogP | 6.57 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.61 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|