C33H33N5O6S3 — CID 58642438
4-[3-[(5Z)-5-[[4-[4-(2-hydroxyethylamino)quinazolin-6-yl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-(morpholin-4-ylmethyl)benzoic acid (PubChem CID 58642438) has the molecular formula C33H33N5O6S3 and a molecular weight of 691.86 g/mol. Its IUPAC name is 4-[3-[(5Z)-5-[[4-[4-(2-hydroxyethylamino)quinazolin-6-yl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-(morpholin-4-ylmethyl)benzoic acid.
| Compound Name | 4-[3-[(5Z)-5-[[4-[4-(2-hydroxyethylamino)quinazolin-6-yl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-(morpholin-4-ylmethyl)benzoic acid |
|---|---|
| PubChem CID | 58642438 |
| Molecular Formula | C33H33N5O6S3 |
| Molecular Weight | 691.86 g/mol |
| Exact Mass | 691.16 |
| IUPAC Name | 4-[3-[(5Z)-5-[[4-[4-(2-hydroxyethylamino)quinazolin-6-yl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propoxy]-3-(morpholin-4-ylmethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(OCCCN2C(=O)/C(=C/c3cc(-c4ccc5ncnc(NCCO)c5c4)cs3)SC2=S)c(CN2CCOCC2)c1 |
| InChI | InChI=1S/C33H33N5O6S3/c39-10-6-34-30-26-16-21(2-4-27(26)35-20-36-30)24-15-25(46-19-24)17-29-31(40)38(33(45)47-29)7-1-11-44-28-5-3-22(32(41)42)14-23(28)18-37-8-12-43-13-9-37/h2-5,14-17,19-20,39H,1,6-13,18H2,(H,41,42)(H,34,35,36)/b29-17- |
| InChIKey | WPWFZSFLKMSPTG-RHANQZHGSA-N |
| XLogP | 4.96 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.86 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|