C23H15ClF6N4O6S2 — CID 91293146
2-[[2-[[2-[5-[[6-[3,5-bis(trifluoromethyl)phenyl]-3-chloro-4-oxo-1H-pyridin-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]acetyl]amino]acetic acid (PubChem CID 91293146) has the molecular formula C23H15ClF6N4O6S2 and a molecular weight of 656.97 g/mol. Its IUPAC name is 2-[[2-[[2-[5-[[6-[3,5-bis(trifluoromethyl)phenyl]-3-chloro-4-oxo-1H-pyridin-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[5-[[6-[3,5-bis(trifluoromethyl)phenyl]-3-chloro-4-oxo-1H-pyridin-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 91293146 |
| Molecular Formula | C23H15ClF6N4O6S2 |
| Molecular Weight | 656.97 g/mol |
| Exact Mass | 656.00 |
| IUPAC Name | 2-[[2-[[2-[5-[[6-[3,5-bis(trifluoromethyl)phenyl]-3-chloro-4-oxo-1H-pyridin-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CNC(=O)CN1C(=O)C(=Cc2[nH]c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc(=O)c2Cl)SC1=S |
| InChI | InChI=1S/C23H15ClF6N4O6S2/c24-19-13(5-15-20(40)34(21(41)42-15)8-17(37)31-6-16(36)32-7-18(38)39)33-12(4-14(19)35)9-1-10(22(25,26)27)3-11(2-9)23(28,29)30/h1-5H,6-8H2,(H,31,37)(H,32,36)(H,33,35)(H,38,39) |
| InChIKey | VMTNFBHBNWZUMV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.97 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|