C23H15ClF3N3O4S2 — CID 17026987
2-[(5E)-5-[[1-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 17026987) has the molecular formula C23H15ClF3N3O4S2 and a molecular weight of 553.97 g/mol. Its IUPAC name is 2-[(5E)-5-[[1-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[[1-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 17026987 |
| Molecular Formula | C23H15ClF3N3O4S2 |
| Molecular Weight | 553.97 g/mol |
| Exact Mass | 553.01 |
| IUPAC Name | 2-[(5E)-5-[[1-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)/C(=C\c2cn(CC(=O)Nc3cc(C(F)(F)F)ccc3Cl)c3ccccc23)SC1=S |
| InChI | InChI=1S/C23H15ClF3N3O4S2/c24-15-6-5-13(23(25,26)27)8-16(15)28-19(31)10-29-9-12(14-3-1-2-4-17(14)29)7-18-21(34)30(11-20(32)33)22(35)36-18/h1-9H,10-11H2,(H,28,31)(H,32,33)/b18-7+ |
| InChIKey | YDELYXMBYJAPAX-CNHKJKLMSA-N |
| XLogP | 5.24 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.97 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|