C23H17N3O6S2 — CID 3890291
2-[5-[[1-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 3890291) has the molecular formula C23H17N3O6S2 and a molecular weight of 495.54 g/mol. Its IUPAC name is 2-[5-[[1-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[5-[[1-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 3890291 |
| Molecular Formula | C23H17N3O6S2 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | 2-[5-[[1-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C(=Cc2cn(CC(=O)Nc3ccc4c(c3)OCO4)c3ccccc23)SC1=S |
| InChI | InChI=1S/C23H17N3O6S2/c27-20(24-14-5-6-17-18(8-14)32-12-31-17)10-25-9-13(15-3-1-2-4-16(15)25)7-19-22(30)26(11-21(28)29)23(33)34-19/h1-9H,10-12H2,(H,24,27)(H,28,29) |
| InChIKey | HNGJYKDTTPGYCN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|