C28H20BrN3O5S — CID 126279380
N-(1,3-benzodioxol-5-yl)-2-[3-[(Z)-[3-[(3-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide (PubChem CID 126279380) has the molecular formula C28H20BrN3O5S and a molecular weight of 590.46 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[3-[(Z)-[3-[(3-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[3-[(Z)-[3-[(3-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 126279380 |
| Molecular Formula | C28H20BrN3O5S |
| Molecular Weight | 590.46 g/mol |
| Exact Mass | 589.03 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[3-[(Z)-[3-[(3-bromophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(/C=C2\SC(=O)N(Cc3cccc(Br)c3)C2=O)c2ccccc21)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H20BrN3O5S/c29-19-5-3-4-17(10-19)13-32-27(34)25(38-28(32)35)11-18-14-31(22-7-2-1-6-21(18)22)15-26(33)30-20-8-9-23-24(12-20)37-16-36-23/h1-12,14H,13,15-16H2,(H,30,33)/b25-11- |
| InChIKey | JFCHJLLRNUFSBC-GATIEOLUSA-N |
| XLogP | 6.01 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.46 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|