C21H13ClF3N3O3S — CID 71951950
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[3-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetamide (PubChem CID 71951950) has the molecular formula C21H13ClF3N3O3S and a molecular weight of 479.87 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[3-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[3-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 71951950 |
| Molecular Formula | C21H13ClF3N3O3S |
| Molecular Weight | 479.87 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[3-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(C=C2SC(=O)NC2=O)c2ccccc21)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C21H13ClF3N3O3S/c22-14-6-5-12(21(23,24)25)8-15(14)26-18(29)10-28-9-11(13-3-1-2-4-16(13)28)7-17-19(30)27-20(31)32-17/h1-9H,10H2,(H,26,29)(H,27,30,31) |
| InChIKey | WGIRVNBSXLTLLB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.87 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|