C14H10Cl2N2O4S2 — CID 16629347
2-[[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]acetic acid (PubChem CID 16629347) has the molecular formula C14H10Cl2N2O4S2 and a molecular weight of 405.28 g/mol. Its IUPAC name is 2-[[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 16629347 |
| Molecular Formula | C14H10Cl2N2O4S2 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 403.95 |
| IUPAC Name | 2-[[2-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CN1C(=O)/C(=C/c2cccc(Cl)c2Cl)SC1=S |
| InChI | InChI=1S/C14H10Cl2N2O4S2/c15-8-3-1-2-7(12(8)16)4-9-13(22)18(14(23)24-9)6-10(19)17-5-11(20)21/h1-4H,5-6H2,(H,17,19)(H,20,21)/b9-4- |
| InChIKey | GJRMILGCZNREBZ-WTKPLQERSA-N |
| XLogP | 2.40 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|