C14H12N2O6S — CID 16632277
2-[[2-[(5Z)-5-[(2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]acetic acid (PubChem CID 16632277) has the molecular formula C14H12N2O6S and a molecular weight of 336.33 g/mol. Its IUPAC name is 2-[[2-[(5Z)-5-[(2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[(5Z)-5-[(2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 16632277 |
| Molecular Formula | C14H12N2O6S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 2-[[2-[(5Z)-5-[(2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CN1C(=O)S/C(=C\c2ccccc2O)C1=O |
| InChI | InChI=1S/C14H12N2O6S/c17-9-4-2-1-3-8(9)5-10-13(21)16(14(22)23-10)7-11(18)15-6-12(19)20/h1-5,17H,6-7H2,(H,15,18)(H,19,20)/b10-5- |
| InChIKey | IBUVROBDYBYQOW-YHYXMXQVSA-N |
| XLogP | 0.63 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|