C13H11Cl2NO2S2 — CID 17470474
(5E)-5-[(2,3-dichlorophenyl)methylidene]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 17470474) has the molecular formula C13H11Cl2NO2S2 and a molecular weight of 348.28 g/mol. Its IUPAC name is (5E)-5-[(2,3-dichlorophenyl)methylidene]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(2,3-dichlorophenyl)methylidene]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 17470474 |
| Molecular Formula | C13H11Cl2NO2S2 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 346.96 |
| IUPAC Name | (5E)-5-[(2,3-dichlorophenyl)methylidene]-3-(2-methoxyethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COCCN1C(=O)/C(=C\c2cccc(Cl)c2Cl)SC1=S |
| InChI | InChI=1S/C13H11Cl2NO2S2/c1-18-6-5-16-12(17)10(20-13(16)19)7-8-3-2-4-9(14)11(8)15/h2-4,7H,5-6H2,1H3/b10-7+ |
| InChIKey | IBAHWMXWAQHORJ-JXMROGBWSA-N |
| XLogP | 3.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|