C16H16Cl2N2O2S2 — CID 24564696
(5Z)-5-[(2,3-dichlorophenyl)methylidene]-3-(2-morpholin-4-ylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 24564696) has the molecular formula C16H16Cl2N2O2S2 and a molecular weight of 403.36 g/mol. Its IUPAC name is (5Z)-5-[(2,3-dichlorophenyl)methylidene]-3-(2-morpholin-4-ylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(2,3-dichlorophenyl)methylidene]-3-(2-morpholin-4-ylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 24564696 |
| Molecular Formula | C16H16Cl2N2O2S2 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | (5Z)-5-[(2,3-dichlorophenyl)methylidene]-3-(2-morpholin-4-ylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cccc(Cl)c2Cl)SC(=S)N1CCN1CCOCC1 |
| InChI | InChI=1S/C16H16Cl2N2O2S2/c17-12-3-1-2-11(14(12)18)10-13-15(21)20(16(23)24-13)5-4-19-6-8-22-9-7-19/h1-3,10H,4-9H2/b13-10- |
| InChIKey | DWVFUIFAAMOOQO-RAXLEYEMSA-N |
| XLogP | 3.53 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|