C12H7Cl2NO3S2 — CID 2854137
2-[5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 2854137) has the molecular formula C12H7Cl2NO3S2 and a molecular weight of 348.23 g/mol. Its IUPAC name is 2-[5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 2854137 |
| Molecular Formula | C12H7Cl2NO3S2 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 346.92 |
| IUPAC Name | 2-[5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C(=Cc2cccc(Cl)c2Cl)SC1=S |
| InChI | InChI=1S/C12H7Cl2NO3S2/c13-7-3-1-2-6(10(7)14)4-8-11(18)15(5-9(16)17)12(19)20-8/h1-4H,5H2,(H,16,17) |
| InChIKey | YYRLVKBVJKUTJD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|