C13H9NO5S2 — CID 6999394
2-[(E)-[3-(carboxymethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoic acid (PubChem CID 6999394) has the molecular formula C13H9NO5S2 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-[(E)-[3-(carboxymethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoic acid.
| Compound Name | 2-[(E)-[3-(carboxymethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 6999394 |
| Molecular Formula | C13H9NO5S2 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | 2-[(E)-[3-(carboxymethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
| SMILES | O=C(O)CN1C(=O)/C(=C\c2ccccc2C(=O)O)SC1=S |
| InChI | InChI=1S/C13H9NO5S2/c15-10(16)6-14-11(17)9(21-13(14)20)5-7-3-1-2-4-8(7)12(18)19/h1-5H,6H2,(H,15,16)(H,18,19)/b9-5+ |
| InChIKey | SCLUBSIOAGDLQL-WEVVVXLNSA-N |
| XLogP | 1.67 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|