C18H18Cl2N2O4S2 — CID 16630544
4-[4-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]butanoic acid (PubChem CID 16630544) has the molecular formula C18H18Cl2N2O4S2 and a molecular weight of 461.39 g/mol. Its IUPAC name is 4-[4-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]butanoic acid.
| Compound Name | 4-[4-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]butanoic acid |
|---|---|
| PubChem CID | 16630544 |
| Molecular Formula | C18H18Cl2N2O4S2 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | 4-[4-[(5Z)-5-[(2,3-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)CCCN1C(=O)/C(=C/c2cccc(Cl)c2Cl)SC1=S |
| InChI | InChI=1S/C18H18Cl2N2O4S2/c19-12-5-1-4-11(16(12)20)10-13-17(26)22(18(27)28-13)9-3-6-14(23)21-8-2-7-15(24)25/h1,4-5,10H,2-3,6-9H2,(H,21,23)(H,24,25)/b13-10- |
| InChIKey | XXYWVLVXLHIQFA-RAXLEYEMSA-N |
| XLogP | 3.96 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|