C29H27ClN2O5S3 — CID 58644201
tert-butyl 4-[3-[(5Z)-5-[[4-[5-chloro-2-(hydroxymethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate (PubChem CID 58644201) has the molecular formula C29H27ClN2O5S3 and a molecular weight of 615.20 g/mol. Its IUPAC name is tert-butyl 4-[3-[(5Z)-5-[[4-[5-chloro-2-(hydroxymethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate.
| Compound Name | tert-butyl 4-[3-[(5Z)-5-[[4-[5-chloro-2-(hydroxymethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 58644201 |
| Molecular Formula | C29H27ClN2O5S3 |
| Molecular Weight | 615.20 g/mol |
| Exact Mass | 614.08 |
| IUPAC Name | tert-butyl 4-[3-[(5Z)-5-[[4-[5-chloro-2-(hydroxymethyl)phenyl]thiophen-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(NC(=O)CCN2C(=O)/C(=C/c3cc(-c4cc(Cl)ccc4CO)cs3)SC2=S)cc1 |
| InChI | InChI=1S/C29H27ClN2O5S3/c1-29(2,3)37-27(36)17-5-8-21(9-6-17)31-25(34)10-11-32-26(35)24(40-28(32)38)14-22-12-19(16-39-22)23-13-20(30)7-4-18(23)15-33/h4-9,12-14,16,33H,10-11,15H2,1-3H3,(H,31,34)/b24-14- |
| InChIKey | PKUOFBZEUNYQHG-OYKKKHCWSA-N |
| XLogP | 6.75 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.20 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|