C14H8Cl2N4O3S2 — CID 25170973
2-[(5Z)-5-[[1-(2,4-dichlorophenyl)triazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 25170973) has the molecular formula C14H8Cl2N4O3S2 and a molecular weight of 415.28 g/mol. Its IUPAC name is 2-[(5Z)-5-[[1-(2,4-dichlorophenyl)triazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[[1-(2,4-dichlorophenyl)triazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 25170973 |
| Molecular Formula | C14H8Cl2N4O3S2 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 413.94 |
| IUPAC Name | 2-[(5Z)-5-[[1-(2,4-dichlorophenyl)triazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)/C(=C/c2cn(-c3ccc(Cl)cc3Cl)nn2)SC1=S |
| InChI | InChI=1S/C14H8Cl2N4O3S2/c15-7-1-2-10(9(16)3-7)20-5-8(17-18-20)4-11-13(23)19(6-12(21)22)14(24)25-11/h1-5H,6H2,(H,21,22)/b11-4- |
| InChIKey | DPRRNBNLQOSWEN-WCIBSUBMSA-N |
| XLogP | 2.86 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|