C15H12N4O4S2 — CID 25171598
2-[(5Z)-5-[[1-(4-methoxyphenyl)triazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 25171598) has the molecular formula C15H12N4O4S2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 2-[(5Z)-5-[[1-(4-methoxyphenyl)triazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[[1-(4-methoxyphenyl)triazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 25171598 |
| Molecular Formula | C15H12N4O4S2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 2-[(5Z)-5-[[1-(4-methoxyphenyl)triazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | COc1ccc(-n2cc(/C=C3\SC(=S)N(CC(=O)O)C3=O)nn2)cc1 |
| InChI | InChI=1S/C15H12N4O4S2/c1-23-11-4-2-10(3-5-11)19-7-9(16-17-19)6-12-14(22)18(8-13(20)21)15(24)25-12/h2-7H,8H2,1H3,(H,20,21)/b12-6- |
| InChIKey | NJWSGEHNVIIZOE-SDQBBNPISA-N |
| XLogP | 1.56 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|