C16H11ClN2O4S2 — CID 17129594
2-[(5E)-5-[(4-chloro-6-methoxyquinolin-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 17129594) has the molecular formula C16H11ClN2O4S2 and a molecular weight of 394.86 g/mol. Its IUPAC name is 2-[(5E)-5-[(4-chloro-6-methoxyquinolin-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[(4-chloro-6-methoxyquinolin-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 17129594 |
| Molecular Formula | C16H11ClN2O4S2 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | 2-[(5E)-5-[(4-chloro-6-methoxyquinolin-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | COc1ccc2nc(/C=C3/SC(=S)N(CC(=O)O)C3=O)cc(Cl)c2c1 |
| InChI | InChI=1S/C16H11ClN2O4S2/c1-23-9-2-3-12-10(6-9)11(17)4-8(18-12)5-13-15(22)19(7-14(20)21)16(24)25-13/h2-6H,7H2,1H3,(H,20,21)/b13-5+ |
| InChIKey | PDXRYXUSUOIVLK-WLRTZDKTSA-N |
| XLogP | 3.18 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|