C21H16N2O2S2 — CID 46859336
(5Z)-3-benzyl-5-[(6-methoxyquinolin-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 46859336) has the molecular formula C21H16N2O2S2 and a molecular weight of 392.51 g/mol. Its IUPAC name is (5Z)-3-benzyl-5-[(6-methoxyquinolin-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-benzyl-5-[(6-methoxyquinolin-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 46859336 |
| Molecular Formula | C21H16N2O2S2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | (5Z)-3-benzyl-5-[(6-methoxyquinolin-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc2nc(/C=C3\SC(=S)N(Cc4ccccc4)C3=O)ccc2c1 |
| InChI | InChI=1S/C21H16N2O2S2/c1-25-17-9-10-18-15(11-17)7-8-16(22-18)12-19-20(24)23(21(26)27-19)13-14-5-3-2-4-6-14/h2-12H,13H2,1H3/b19-12- |
| InChIKey | VBCPNPFWTJVVQZ-UNOMPAQXSA-N |
| XLogP | 4.64 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|