C19H20N2O2S2 — CID 126142934
(5Z)-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-5-[(1,2,5-trimethylpyrrol-3-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 126142934) has the molecular formula C19H20N2O2S2 and a molecular weight of 372.52 g/mol. Its IUPAC name is (5Z)-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-5-[(1,2,5-trimethylpyrrol-3-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-5-[(1,2,5-trimethylpyrrol-3-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126142934 |
| Molecular Formula | C19H20N2O2S2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | (5Z)-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-5-[(1,2,5-trimethylpyrrol-3-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CN2C(=O)/C(=C/c3cc(C)n(C)c3C)SC2=S)cc1 |
| InChI | InChI=1S/C19H20N2O2S2/c1-12-9-15(13(2)20(12)3)10-17-18(22)21(19(24)25-17)11-14-5-7-16(23-4)8-6-14/h5-10H,11H2,1-4H3/b17-10- |
| InChIKey | XZATXCCXQDFDIW-YVLHZVERSA-N |
| XLogP | 4.05 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|