C19H14ClNO4S2 — CID 2286285
(5Z)-5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 2286285) has the molecular formula C19H14ClNO4S2 and a molecular weight of 419.91 g/mol. Its IUPAC name is (5Z)-5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2286285 |
| Molecular Formula | C19H14ClNO4S2 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | (5Z)-5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-[(4-methoxyphenyl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CN2C(=O)/C(=C/c3cc4c(cc3Cl)OCO4)SC2=S)cc1 |
| InChI | InChI=1S/C19H14ClNO4S2/c1-23-13-4-2-11(3-5-13)9-21-18(22)17(27-19(21)26)7-12-6-15-16(8-14(12)20)25-10-24-15/h2-8H,9-10H2,1H3/b17-7- |
| InChIKey | QJAPOZUOQPMEEV-IDUWFGFVSA-N |
| XLogP | 4.48 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|