C18H12ClNO4S2 — CID 76728297
3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[(3-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 76728297) has the molecular formula C18H12ClNO4S2 and a molecular weight of 405.88 g/mol. Its IUPAC name is 3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[(3-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[(3-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 76728297 |
| Molecular Formula | C18H12ClNO4S2 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | 3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[(3-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2cccc(O)c2)SC(=S)N1Cc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C18H12ClNO4S2/c19-13-7-15-14(23-9-24-15)6-11(13)8-20-17(22)16(26-18(20)25)5-10-2-1-3-12(21)4-10/h1-7,21H,8-9H2 |
| InChIKey | JGUOXANNYONLEK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|