C12H10NO5S3- — CID 7729974
2-[(5Z)-5-[(3-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonate (PubChem CID 7729974) has the molecular formula C12H10NO5S3- and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-[(5Z)-5-[(3-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonate.
| Compound Name | 2-[(5Z)-5-[(3-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonate |
|---|---|
| PubChem CID | 7729974 |
| Molecular Formula | C12H10NO5S3- |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 2-[(5Z)-5-[(3-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonate |
| SMILES | O=C1/C(=C/c2cccc(O)c2)SC(=S)N1CCS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H11NO5S3/c14-9-3-1-2-8(6-9)7-10-11(15)13(12(19)20-10)4-5-21(16,17)18/h1-3,6-7,14H,4-5H2,(H,16,17,18)/p-1/b10-7- |
| InChIKey | VIWFQMLNWMVYBB-YFHOEESVSA-M |
| XLogP | 1.14 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|