C14H12NO4S3- — CID 2188140
2-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonate (PubChem CID 2188140) has the molecular formula C14H12NO4S3- and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonate.
| Compound Name | 2-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonate |
|---|---|
| PubChem CID | 2188140 |
| Molecular Formula | C14H12NO4S3- |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | 2-[(5Z)-4-oxo-5-[(E)-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]ethanesulfonate |
| SMILES | O=C1/C(=C/C=C/c2ccccc2)SC(=S)N1CCS(=O)(=O)[O-] |
| InChI | InChI=1S/C14H13NO4S3/c16-13-12(8-4-7-11-5-2-1-3-6-11)21-14(20)15(13)9-10-22(17,18)19/h1-8H,9-10H2,(H,17,18,19)/p-1/b7-4+,12-8- |
| InChIKey | WNPZOZGDQWKCNS-JHLWKMQHSA-M |
| XLogP | 1.99 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|