C21H19NO4S2 — CID 157366879
3-(2,3-dihydro-1-benzofuran-6-ylmethyl)-5-[(2,4-dimethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 157366879) has the molecular formula C21H19NO4S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-6-ylmethyl)-5-[(2,4-dimethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-6-ylmethyl)-5-[(2,4-dimethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 157366879 |
| Molecular Formula | C21H19NO4S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-6-ylmethyl)-5-[(2,4-dimethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(C=C2SC(=S)N(Cc3ccc4c(c3)OCC4)C2=O)c(OC)c1 |
| InChI | InChI=1S/C21H19NO4S2/c1-24-16-6-5-15(17(11-16)25-2)10-19-20(23)22(21(27)28-19)12-13-3-4-14-7-8-26-18(14)9-13/h3-6,9-11H,7-8,12H2,1-2H3 |
| InChIKey | XUOVHUZQMFRMIO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|