C15H10N2O4S2 — CID 24796773
2-[(5Z)-4-oxo-5-[(5-phenyl-1,2-oxazol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 24796773) has the molecular formula C15H10N2O4S2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-[(5Z)-4-oxo-5-[(5-phenyl-1,2-oxazol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-4-oxo-5-[(5-phenyl-1,2-oxazol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 24796773 |
| Molecular Formula | C15H10N2O4S2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 2-[(5Z)-4-oxo-5-[(5-phenyl-1,2-oxazol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)/C(=C/c2cc(-c3ccccc3)on2)SC1=S |
| InChI | InChI=1S/C15H10N2O4S2/c18-13(19)8-17-14(20)12(23-15(17)22)7-10-6-11(21-16-10)9-4-2-1-3-5-9/h1-7H,8H2,(H,18,19)/b12-7- |
| InChIKey | VJTLPGXZPWOGFN-GHXNOFRVSA-N |
| XLogP | 2.63 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|