C20H15F2NO4S2 — CID 72654582
4-[5-[[2-(3,4-difluorophenoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 72654582) has the molecular formula C20H15F2NO4S2 and a molecular weight of 435.47 g/mol. Its IUPAC name is 4-[5-[[2-(3,4-difluorophenoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[5-[[2-(3,4-difluorophenoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 72654582 |
| Molecular Formula | C20H15F2NO4S2 |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | 4-[5-[[2-(3,4-difluorophenoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C(=Cc2ccccc2Oc2ccc(F)c(F)c2)SC1=S |
| InChI | InChI=1S/C20H15F2NO4S2/c21-14-8-7-13(11-15(14)22)27-16-5-2-1-4-12(16)10-17-19(26)23(20(28)29-17)9-3-6-18(24)25/h1-2,4-5,7-8,10-11H,3,6,9H2,(H,24,25) |
| InChIKey | RFJMTLPIQSYETJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|