C23H19FN2O4S2 — CID 72654829
4-[5-[[2-(4-fluorophenoxy)-1-methylindol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 72654829) has the molecular formula C23H19FN2O4S2 and a molecular weight of 470.55 g/mol. Its IUPAC name is 4-[5-[[2-(4-fluorophenoxy)-1-methylindol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[5-[[2-(4-fluorophenoxy)-1-methylindol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 72654829 |
| Molecular Formula | C23H19FN2O4S2 |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 4-[5-[[2-(4-fluorophenoxy)-1-methylindol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | Cn1c(Oc2ccc(F)cc2)c(C=C2SC(=S)N(CCCC(=O)O)C2=O)c2ccccc21 |
| InChI | InChI=1S/C23H19FN2O4S2/c1-25-18-6-3-2-5-16(18)17(22(25)30-15-10-8-14(24)9-11-15)13-19-21(29)26(23(31)32-19)12-4-7-20(27)28/h2-3,5-6,8-11,13H,4,7,12H2,1H3,(H,27,28) |
| InChIKey | HOKYZCMMNPTYKR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|