C16H12N2O6S3 — CID 72655040
4-[5-[[4-(4-nitrofuran-3-yl)thiophen-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 72655040) has the molecular formula C16H12N2O6S3 and a molecular weight of 424.48 g/mol. Its IUPAC name is 4-[5-[[4-(4-nitrofuran-3-yl)thiophen-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[5-[[4-(4-nitrofuran-3-yl)thiophen-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 72655040 |
| Molecular Formula | C16H12N2O6S3 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 423.99 |
| IUPAC Name | 4-[5-[[4-(4-nitrofuran-3-yl)thiophen-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C(=Cc2cscc2-c2cocc2[N+](=O)[O-])SC1=S |
| InChI | InChI=1S/C16H12N2O6S3/c19-14(20)2-1-3-17-15(21)13(27-16(17)25)4-9-7-26-8-11(9)10-5-24-6-12(10)18(22)23/h4-8H,1-3H2,(H,19,20) |
| InChIKey | AXEKXAKJFOLFFU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 113.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|