C18H15N3O7S3 — CID 72655448
4-[5-[[1-(2-nitrophenyl)sulfonylpyrrol-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 72655448) has the molecular formula C18H15N3O7S3 and a molecular weight of 481.53 g/mol. Its IUPAC name is 4-[5-[[1-(2-nitrophenyl)sulfonylpyrrol-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[5-[[1-(2-nitrophenyl)sulfonylpyrrol-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 72655448 |
| Molecular Formula | C18H15N3O7S3 |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | 4-[5-[[1-(2-nitrophenyl)sulfonylpyrrol-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C(=Cc2cccn2S(=O)(=O)c2ccccc2[N+](=O)[O-])SC1=S |
| InChI | InChI=1S/C18H15N3O7S3/c22-16(23)8-4-9-19-17(24)14(30-18(19)29)11-12-5-3-10-20(12)31(27,28)15-7-2-1-6-13(15)21(25)26/h1-3,5-7,10-11H,4,8-9H2,(H,22,23) |
| InChIKey | JCWSFVORQXPONQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|