C18H14N4O6S2 — CID 91329041
5-[[1-(2-nitrophenyl)sulfonylpyrrol-2-yl]methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 91329041) has the molecular formula C18H14N4O6S2 and a molecular weight of 446.47 g/mol. Its IUPAC name is 5-[[1-(2-nitrophenyl)sulfonylpyrrol-2-yl]methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[1-(2-nitrophenyl)sulfonylpyrrol-2-yl]methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 91329041 |
| Molecular Formula | C18H14N4O6S2 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 5-[[1-(2-nitrophenyl)sulfonylpyrrol-2-yl]methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C=CCN1C(=O)C(=Cc2cccn2S(=O)(=O)c2ccccc2[N+](=O)[O-])C(=O)NC1=S |
| InChI | InChI=1S/C18H14N4O6S2/c1-2-9-20-17(24)13(16(23)19-18(20)29)11-12-6-5-10-21(12)30(27,28)15-8-4-3-7-14(15)22(25)26/h2-8,10-11H,1,9H2,(H,19,23,29) |
| InChIKey | CYWJKXDSLFLARQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|