C18H13F2N3O4S2 — CID 90844514
5-[[1-(2,4-difluorophenyl)sulfonylpyrrol-2-yl]methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 90844514) has the molecular formula C18H13F2N3O4S2 and a molecular weight of 437.45 g/mol. Its IUPAC name is 5-[[1-(2,4-difluorophenyl)sulfonylpyrrol-2-yl]methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[1-(2,4-difluorophenyl)sulfonylpyrrol-2-yl]methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 90844514 |
| Molecular Formula | C18H13F2N3O4S2 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | 5-[[1-(2,4-difluorophenyl)sulfonylpyrrol-2-yl]methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C=CCN1C(=O)C(=Cc2cccn2S(=O)(=O)c2ccc(F)cc2F)C(=O)NC1=S |
| InChI | InChI=1S/C18H13F2N3O4S2/c1-2-7-22-17(25)13(16(24)21-18(22)28)10-12-4-3-8-23(12)29(26,27)15-6-5-11(19)9-14(15)20/h2-6,8-10H,1,7H2,(H,21,24,28) |
| InChIKey | FXNPEKSCJQDOLQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|