C21H15ClN4O6S2 — CID 91507362
1-(4-chlorophenyl)-5-[[1-[2-(dihydroxyamino)phenyl]sulfonylpyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 91507362) has the molecular formula C21H15ClN4O6S2 and a molecular weight of 518.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[[1-[2-(dihydroxyamino)phenyl]sulfonylpyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1-(4-chlorophenyl)-5-[[1-[2-(dihydroxyamino)phenyl]sulfonylpyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 91507362 |
| Molecular Formula | C21H15ClN4O6S2 |
| Molecular Weight | 518.96 g/mol |
| Exact Mass | 518.01 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[[1-[2-(dihydroxyamino)phenyl]sulfonylpyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)N(c2ccc(Cl)cc2)C(=O)C1=Cc1cccn1S(=O)(=O)c1ccccc1N(O)O |
| InChI | InChI=1S/C21H15ClN4O6S2/c22-13-7-9-14(10-8-13)25-20(28)16(19(27)23-21(25)33)12-15-4-3-11-24(15)34(31,32)18-6-2-1-5-17(18)26(29)30/h1-12,29-30H,(H,23,27,33) |
| InChIKey | KJKXJPJGQWJADZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 132.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.96 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|