C17H11ClN2O8S3 — CID 90878983
4-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]benzene-1,3-disulfonic acid (PubChem CID 90878983) has the molecular formula C17H11ClN2O8S3 and a molecular weight of 502.94 g/mol. Its IUPAC name is 4-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]benzene-1,3-disulfonic acid.
| Compound Name | 4-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 90878983 |
| Molecular Formula | C17H11ClN2O8S3 |
| Molecular Weight | 502.94 g/mol |
| Exact Mass | 501.94 |
| IUPAC Name | 4-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]benzene-1,3-disulfonic acid |
| SMILES | O=C1NC(=S)N(c2ccc(Cl)cc2)C(=O)C1=Cc1ccc(S(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C17H11ClN2O8S3/c18-10-2-4-11(5-3-10)20-16(22)13(15(21)19-17(20)29)7-9-1-6-12(30(23,24)25)8-14(9)31(26,27)28/h1-8H,(H,19,21,29)(H,23,24,25)(H,26,27,28) |
| InChIKey | CLBSJPBXHKBXCY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.94 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|