C18H11ClN2O5S — CID 91425651
3-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-hydroxybenzoic acid (PubChem CID 91425651) has the molecular formula C18H11ClN2O5S and a molecular weight of 402.82 g/mol. Its IUPAC name is 3-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-hydroxybenzoic acid.
| Compound Name | 3-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 91425651 |
| Molecular Formula | C18H11ClN2O5S |
| Molecular Weight | 402.82 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 3-[[1-(4-chlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-hydroxybenzoic acid |
| SMILES | O=C1NC(=S)N(c2ccc(Cl)cc2)C(=O)C1=Cc1cccc(C(=O)O)c1O |
| InChI | InChI=1S/C18H11ClN2O5S/c19-10-4-6-11(7-5-10)21-16(24)13(15(23)20-18(21)27)8-9-2-1-3-12(14(9)22)17(25)26/h1-8,22H,(H,25,26)(H,20,23,27) |
| InChIKey | IWAKDZUYTNGRBZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.82 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|