C17H10ClN3O5S — CID 91201701
1-(4-chlorophenyl)-5-[(5-hydroxy-2-nitrophenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 91201701) has the molecular formula C17H10ClN3O5S and a molecular weight of 403.80 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[(5-hydroxy-2-nitrophenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1-(4-chlorophenyl)-5-[(5-hydroxy-2-nitrophenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 91201701 |
| Molecular Formula | C17H10ClN3O5S |
| Molecular Weight | 403.80 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[(5-hydroxy-2-nitrophenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)N(c2ccc(Cl)cc2)C(=O)C1=Cc1cc(O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H10ClN3O5S/c18-10-1-3-11(4-2-10)20-16(24)13(15(23)19-17(20)27)8-9-7-12(22)5-6-14(9)21(25)26/h1-8,22H,(H,19,23,27) |
| InChIKey | BASGCHKGERXZBT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.80 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|