C18H12ClN3O5S — CID 91249309
1-(4-chlorophenyl)-5-[(2-methoxy-5-nitrophenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 91249309) has the molecular formula C18H12ClN3O5S and a molecular weight of 417.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[(2-methoxy-5-nitrophenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1-(4-chlorophenyl)-5-[(2-methoxy-5-nitrophenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 91249309 |
| Molecular Formula | C18H12ClN3O5S |
| Molecular Weight | 417.83 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[(2-methoxy-5-nitrophenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1ccc([N+](=O)[O-])cc1C=C1C(=O)NC(=S)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C18H12ClN3O5S/c1-27-15-7-6-13(22(25)26)8-10(15)9-14-16(23)20-18(28)21(17(14)24)12-4-2-11(19)3-5-12/h2-9H,1H3,(H,20,23,28) |
| InChIKey | ZZEIUSFOBZZYCL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.83 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|