C25H18ClN3O6S — CID 91608986
1-(4-chlorophenyl)-5-[[4-methoxy-3-[(4-nitrophenoxy)methyl]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 91608986) has the molecular formula C25H18ClN3O6S and a molecular weight of 523.95 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[[4-methoxy-3-[(4-nitrophenoxy)methyl]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1-(4-chlorophenyl)-5-[[4-methoxy-3-[(4-nitrophenoxy)methyl]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 91608986 |
| Molecular Formula | C25H18ClN3O6S |
| Molecular Weight | 523.95 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[[4-methoxy-3-[(4-nitrophenoxy)methyl]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1ccc(C=C2C(=O)NC(=S)N(c3ccc(Cl)cc3)C2=O)cc1COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H18ClN3O6S/c1-34-22-11-2-15(12-16(22)14-35-20-9-7-19(8-10-20)29(32)33)13-21-23(30)27-25(36)28(24(21)31)18-5-3-17(26)4-6-18/h2-13H,14H2,1H3,(H,27,30,36) |
| InChIKey | RZGBTPIIKJQBGY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.95 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|