C29H27N3O6S — CID 3851651
N-[4-[[5-[[1-(4-ethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenyl]methoxy]phenyl]acetamide (PubChem CID 3851651) has the molecular formula C29H27N3O6S and a molecular weight of 545.62 g/mol. Its IUPAC name is N-[4-[[5-[[1-(4-ethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenyl]methoxy]phenyl]acetamide.
| Compound Name | N-[4-[[5-[[1-(4-ethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenyl]methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 3851651 |
| Molecular Formula | C29H27N3O6S |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | N-[4-[[5-[[1-(4-ethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenyl]methoxy]phenyl]acetamide |
| SMILES | CCOc1ccc(N2C(=O)C(=Cc3ccc(OC)c(COc4ccc(NC(C)=O)cc4)c3)C(=O)NC2=S)cc1 |
| InChI | InChI=1S/C29H27N3O6S/c1-4-37-23-12-8-22(9-13-23)32-28(35)25(27(34)31-29(32)39)16-19-5-14-26(36-3)20(15-19)17-38-24-10-6-21(7-11-24)30-18(2)33/h5-16H,4,17H2,1-3H3,(H,30,33)(H,31,34,39) |
| InChIKey | SCHXYAFIRWDUPT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|