C30H29N3O6 — CID 5173291
N-[4-[[2-methoxy-5-[[2,4,6-trioxo-1-(2,4,6-trimethylphenyl)-1,3-diazinan-5-ylidene]methyl]phenyl]methoxy]phenyl]acetamide (PubChem CID 5173291) has the molecular formula C30H29N3O6 and a molecular weight of 527.58 g/mol. Its IUPAC name is N-[4-[[2-methoxy-5-[[2,4,6-trioxo-1-(2,4,6-trimethylphenyl)-1,3-diazinan-5-ylidene]methyl]phenyl]methoxy]phenyl]acetamide.
| Compound Name | N-[4-[[2-methoxy-5-[[2,4,6-trioxo-1-(2,4,6-trimethylphenyl)-1,3-diazinan-5-ylidene]methyl]phenyl]methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 5173291 |
| Molecular Formula | C30H29N3O6 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | N-[4-[[2-methoxy-5-[[2,4,6-trioxo-1-(2,4,6-trimethylphenyl)-1,3-diazinan-5-ylidene]methyl]phenyl]methoxy]phenyl]acetamide |
| SMILES | COc1ccc(C=C2C(=O)NC(=O)N(c3c(C)cc(C)cc3C)C2=O)cc1COc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C30H29N3O6/c1-17-12-18(2)27(19(3)13-17)33-29(36)25(28(35)32-30(33)37)15-21-6-11-26(38-5)22(14-21)16-39-24-9-7-23(8-10-24)31-20(4)34/h6-15H,16H2,1-5H3,(H,31,34)(H,32,35,37) |
| InChIKey | KZMNNEJCKCOELH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|