C22H19N2O6- — CID 7372437
2-[4-[(E)-[2,4,6-trioxo-1-(2,4,6-trimethylphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetate (PubChem CID 7372437) has the molecular formula C22H19N2O6- and a molecular weight of 407.40 g/mol. Its IUPAC name is 2-[4-[(E)-[2,4,6-trioxo-1-(2,4,6-trimethylphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[4-[(E)-[2,4,6-trioxo-1-(2,4,6-trimethylphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 7372437 |
| Molecular Formula | C22H19N2O6- |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 2-[4-[(E)-[2,4,6-trioxo-1-(2,4,6-trimethylphenyl)-1,3-diazinan-5-ylidene]methyl]phenoxy]acetate |
| SMILES | Cc1cc(C)c(N2C(=O)NC(=O)/C(=C\c3ccc(OCC(=O)[O-])cc3)C2=O)c(C)c1 |
| InChI | InChI=1S/C22H20N2O6/c1-12-8-13(2)19(14(3)9-12)24-21(28)17(20(27)23-22(24)29)10-15-4-6-16(7-5-15)30-11-18(25)26/h4-10H,11H2,1-3H3,(H,25,26)(H,23,27,29)/p-1/b17-10+ |
| InChIKey | IHWAINKISWKVAP-LICLKQGHSA-M |
| XLogP | 1.41 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|